C9H9N3O4S — CID 61369143
2-[(6-amino-1,3-benzoxazol-2-yl)sulfonyl]acetamide (PubChem CID 61369143) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzoxazol-2-yl)sulfonyl]acetamide.
| Compound Name | 2-[(6-amino-1,3-benzoxazol-2-yl)sulfonyl]acetamide |
|---|---|
| PubChem CID | 61369143 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[(6-amino-1,3-benzoxazol-2-yl)sulfonyl]acetamide |
| SMILES | NC(=O)CS(=O)(=O)c1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C9H9N3O4S/c10-5-1-2-6-7(3-5)16-9(12-6)17(14,15)4-8(11)13/h1-3H,4,10H2,(H2,11,13) |
| InChIKey | XGTAVYKNCRSGLH-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|