C10H11N3O4S — CID 114231794
2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetamide (PubChem CID 114231794) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetamide.
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 114231794 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetamide |
| SMILES | NC(=O)CS(=O)(=O)Cc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C10H11N3O4S/c11-6-1-2-8-7(3-6)13-10(17-8)5-18(15,16)4-9(12)14/h1-3H,4-5,11H2,(H2,12,14) |
| InChIKey | BCUDIIOODRZHKD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|