C15H20N4O2 — CID 79959943
2-[(5-amino-1,3-benzoxazol-2-yl)methyl-cyclopentylamino]acetamide (PubChem CID 79959943) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)methyl-cyclopentylamino]acetamide.
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methyl-cyclopentylamino]acetamide |
|---|---|
| PubChem CID | 79959943 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methyl-cyclopentylamino]acetamide |
| SMILES | NC(=O)CN(Cc1nc2cc(N)ccc2o1)C1CCCC1 |
| InChI | InChI=1S/C15H20N4O2/c16-10-5-6-13-12(7-10)18-15(21-13)9-19(8-14(17)20)11-3-1-2-4-11/h5-7,11H,1-4,8-9,16H2,(H2,17,20) |
| InChIKey | QVXNGWLAGBAYQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|