C13H11N3O3S — CID 61367044
2-(pyridin-3-ylmethylsulfonyl)-1,3-benzoxazol-6-amine (PubChem CID 61367044) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylsulfonyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(pyridin-3-ylmethylsulfonyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 61367044 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-(pyridin-3-ylmethylsulfonyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)Cc3cccnc3)oc2c1 |
| InChI | InChI=1S/C13H11N3O3S/c14-10-3-4-11-12(6-10)19-13(16-11)20(17,18)8-9-2-1-5-15-7-9/h1-7H,8,14H2 |
| InChIKey | GOAYFYVCLUUMIG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|