C18H24N2O — CID 64744814
3-[(3,4-dimethylcyclohexyl)oxymethyl]quinolin-2-amine (PubChem CID 64744814) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[(3,4-dimethylcyclohexyl)oxymethyl]quinolin-2-amine.
| Compound Name | 3-[(3,4-dimethylcyclohexyl)oxymethyl]quinolin-2-amine |
|---|---|
| PubChem CID | 64744814 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-[(3,4-dimethylcyclohexyl)oxymethyl]quinolin-2-amine |
| SMILES | CC1CCC(OCc2cc3ccccc3nc2N)CC1C |
| InChI | InChI=1S/C18H24N2O/c1-12-7-8-16(9-13(12)2)21-11-15-10-14-5-3-4-6-17(14)20-18(15)19/h3-6,10,12-13,16H,7-9,11H2,1-2H3,(H2,19,20) |
| InChIKey | LHXDGYNTECIVQH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |