About 3-octylquinolin-2-amine
3-octylquinolin-2-amine (PubChem CID 23131231) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-octylquinolin-2-amine.
Molecular Properties
| Compound Name | 3-octylquinolin-2-amine |
| PubChem CID | 23131231 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-octylquinolin-2-amine |
| SMILES | CCCCCCCCc1cc2ccccc2nc1N |
| InChI | InChI=1S/C17H24N2/c1-2-3-4-5-6-7-11-15-13-14-10-8-9-12-16(14)19-17(15)18/h8-10,12-13H,2-7,11H2,1H3,(H2,18,19) |
| InChIKey | ZLCCITMSRGVZQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylquinolin-2-amine?
The IUPAC name of 3-octylquinolin-2-amine (CID 23131231) is 3-octylquinolin-2-amine.
What is the SMILES notation for 3-octylquinolin-2-amine?
The canonical SMILES for 3-octylquinolin-2-amine is CCCCCCCCc1cc2ccccc2nc1N.
What is the InChIKey of 3-octylquinolin-2-amine?
The InChIKey is ZLCCITMSRGVZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-2-3-4-5-6-7-11-15-13-14-10-8-9-12-16(14)19-17(15)18/h8-10,12-13H,2-7,11H2,1H3,(H2,18,19).
What are the key properties of 3-octylquinolin-2-amine?
3-octylquinolin-2-amine has a molecular weight of 256.39 g/mol, XLogP of 4.72, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylquinolin-2-amine is sourced from PubChem (CID 23131231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).