C21H24N2 — CID 122192094
5-benzyl-3-pentylquinolin-2-amine (PubChem CID 122192094) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-benzyl-3-pentylquinolin-2-amine.
| Compound Name | 5-benzyl-3-pentylquinolin-2-amine |
|---|---|
| PubChem CID | 122192094 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 5-benzyl-3-pentylquinolin-2-amine |
| SMILES | CCCCCc1cc2c(Cc3ccccc3)cccc2nc1N |
| InChI | InChI=1S/C21H24N2/c1-2-3-5-11-18-15-19-17(14-16-9-6-4-7-10-16)12-8-13-20(19)23-21(18)22/h4,6-10,12-13,15H,2-3,5,11,14H2,1H3,(H2,22,23) |
| InChIKey | NNRGQKSAVHMAKO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|