C12H12F2N2O — CID 82007215
3-(2,2-difluoroethoxymethyl)quinolin-2-amine (PubChem CID 82007215) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxymethyl)quinolin-2-amine.
| Compound Name | 3-(2,2-difluoroethoxymethyl)quinolin-2-amine |
|---|---|
| PubChem CID | 82007215 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-(2,2-difluoroethoxymethyl)quinolin-2-amine |
| SMILES | Nc1nc2ccccc2cc1COCC(F)F |
| InChI | InChI=1S/C12H12F2N2O/c13-11(14)7-17-6-9-5-8-3-1-2-4-10(8)16-12(9)15/h1-5,11H,6-7H2,(H2,15,16) |
| InChIKey | BLIHBNQBVYQZED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |