C13H12O7S — CID 65293754
5-[(2-methoxy-2-oxoethyl)sulfonylmethyl]-1-benzofuran-2-carboxylic acid (PubChem CID 65293754) has the molecular formula C13H12O7S and a molecular weight of 312.30 g/mol. Its IUPAC name is 5-[(2-methoxy-2-oxoethyl)sulfonylmethyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[(2-methoxy-2-oxoethyl)sulfonylmethyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 65293754 |
| Molecular Formula | C13H12O7S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 5-[(2-methoxy-2-oxoethyl)sulfonylmethyl]-1-benzofuran-2-carboxylic acid |
| SMILES | COC(=O)CS(=O)(=O)Cc1ccc2oc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C13H12O7S/c1-19-12(14)7-21(17,18)6-8-2-3-10-9(4-8)5-11(20-10)13(15)16/h2-5H,6-7H2,1H3,(H,15,16) |
| InChIKey | ACFLVWQWYSYSEW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |