C20H20N2O6 — CID 146166365
ethyl (E)-3-(2-hydroxy-5-methoxyanilino)-2-(5-methoxy-1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 146166365) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl (E)-3-(2-hydroxy-5-methoxyanilino)-2-(5-methoxy-1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-hydroxy-5-methoxyanilino)-2-(5-methoxy-1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 146166365 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethyl (E)-3-(2-hydroxy-5-methoxyanilino)-2-(5-methoxy-1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/Nc1cc(OC)ccc1O)c1nc2cc(OC)ccc2o1 |
| InChI | InChI=1S/C20H20N2O6/c1-4-27-20(24)14(11-21-15-9-12(25-2)5-7-17(15)23)19-22-16-10-13(26-3)6-8-18(16)28-19/h5-11,21,23H,4H2,1-3H3/b14-11+ |
| InChIKey | AZBWKRXEHBJRJX-SDNWHVSQSA-N |
| XLogP | 3.57 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|