C19H16N2O6 — CID 11079108
ethyl (E)-3-[(7-methyl-2,5-dioxopyrano[3,2-c]pyran-3-yl)amino]-2-pyridin-2-ylprop-2-enoate (PubChem CID 11079108) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is ethyl (E)-3-[(7-methyl-2,5-dioxopyrano[3,2-c]pyran-3-yl)amino]-2-pyridin-2-ylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(7-methyl-2,5-dioxopyrano[3,2-c]pyran-3-yl)amino]-2-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 11079108 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (E)-3-[(7-methyl-2,5-dioxopyrano[3,2-c]pyran-3-yl)amino]-2-pyridin-2-ylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/Nc1cc2c(=O)oc(C)cc2oc1=O)c1ccccn1 |
| InChI | InChI=1S/C19H16N2O6/c1-3-25-17(22)13(14-6-4-5-7-20-14)10-21-15-9-12-16(27-19(15)24)8-11(2)26-18(12)23/h4-10,21H,3H2,1-2H3/b13-10+ |
| InChIKey | GXQHCFOKHDWVMQ-JLHYYAGUSA-N |
| XLogP | 2.47 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|