C22H16N2O6 — CID 23245161
ethyl 3-[(2,5-dioxopyrano[3,2-c]chromen-3-yl)amino]-2-pyridin-2-ylprop-2-enoate (PubChem CID 23245161) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is ethyl 3-[(2,5-dioxopyrano[3,2-c]chromen-3-yl)amino]-2-pyridin-2-ylprop-2-enoate.
| Compound Name | ethyl 3-[(2,5-dioxopyrano[3,2-c]chromen-3-yl)amino]-2-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 23245161 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethyl 3-[(2,5-dioxopyrano[3,2-c]chromen-3-yl)amino]-2-pyridin-2-ylprop-2-enoate |
| SMILES | CCOC(=O)C(=CNc1cc2c(=O)oc3ccccc3c2oc1=O)c1ccccn1 |
| InChI | InChI=1S/C22H16N2O6/c1-2-28-20(25)15(16-8-5-6-10-23-16)12-24-17-11-14-19(30-22(17)27)13-7-3-4-9-18(13)29-21(14)26/h3-12,24H,2H2,1H3 |
| InChIKey | UBJTVQDGYYUXJD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|