C18H13N3O4 — CID 2799072
ethyl (E)-2-cyano-3-[(5-oxochromeno[2,3-b]pyridin-7-yl)amino]prop-2-enoate (PubChem CID 2799072) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[(5-oxochromeno[2,3-b]pyridin-7-yl)amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[(5-oxochromeno[2,3-b]pyridin-7-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 2799072 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl (E)-2-cyano-3-[(5-oxochromeno[2,3-b]pyridin-7-yl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccc2oc3ncccc3c(=O)c2c1 |
| InChI | InChI=1S/C18H13N3O4/c1-2-24-18(23)11(9-19)10-21-12-5-6-15-14(8-12)16(22)13-4-3-7-20-17(13)25-15/h3-8,10,21H,2H2,1H3/b11-10+ |
| InChIKey | PQFPJYNXZDKYMY-ZHACJKMWSA-N |
| XLogP | 2.72 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|