C26H20N4O2 — CID 15192373
ethyl (E)-2-cyano-3-[(2,3-diphenylquinoxalin-6-yl)amino]prop-2-enoate (PubChem CID 15192373) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[(2,3-diphenylquinoxalin-6-yl)amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[(2,3-diphenylquinoxalin-6-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 15192373 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | ethyl (E)-2-cyano-3-[(2,3-diphenylquinoxalin-6-yl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C26H20N4O2/c1-2-32-26(31)20(16-27)17-28-21-13-14-22-23(15-21)30-25(19-11-7-4-8-12-19)24(29-22)18-9-5-3-6-10-18/h3-15,17,28H,2H2,1H3/b20-17+ |
| InChIKey | VHMVXMKSHSGHGK-LVZFUZTISA-N |
| XLogP | 5.35 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|