C19H16N4O2 — CID 8811294
ethyl (E)-3-[4-(1H-benzimidazol-2-yl)anilino]-2-cyanoprop-2-enoate (PubChem CID 8811294) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl (E)-3-[4-(1H-benzimidazol-2-yl)anilino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(1H-benzimidazol-2-yl)anilino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 8811294 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl (E)-3-[4-(1H-benzimidazol-2-yl)anilino]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C19H16N4O2/c1-2-25-19(24)14(11-20)12-21-15-9-7-13(8-10-15)18-22-16-5-3-4-6-17(16)23-18/h3-10,12,21H,2H2,1H3,(H,22,23)/b14-12+ |
| InChIKey | MGWXFACBTMIALD-WYMLVPIESA-N |
| XLogP | 3.61 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|