C14H12N4O3 — CID 135603706
ethyl (Z)-2-cyano-3-[(4-oxo-3H-quinazolin-2-yl)amino]prop-2-enoate (PubChem CID 135603706) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[(4-oxo-3H-quinazolin-2-yl)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[(4-oxo-3H-quinazolin-2-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 135603706 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[(4-oxo-3H-quinazolin-2-yl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\Nc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H12N4O3/c1-2-21-13(20)9(7-15)8-16-14-17-11-6-4-3-5-10(11)12(19)18-14/h3-6,8H,2H2,1H3,(H2,16,17,18,19)/b9-8- |
| InChIKey | LSBGPQGOLAOFLN-HJWRWDBZSA-N |
| XLogP | 1.31 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|