C14H12N4O4 — CID 8812181
ethyl (E)-2-cyano-3-[(2,4-dioxo-1H-quinazolin-3-yl)amino]prop-2-enoate (PubChem CID 8812181) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[(2,4-dioxo-1H-quinazolin-3-yl)amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[(2,4-dioxo-1H-quinazolin-3-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 8812181 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | ethyl (E)-2-cyano-3-[(2,4-dioxo-1H-quinazolin-3-yl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C14H12N4O4/c1-2-22-13(20)9(7-15)8-16-18-12(19)10-5-3-4-6-11(10)17-14(18)21/h3-6,8,16H,2H2,1H3,(H,17,21)/b9-8+ |
| InChIKey | BSFDKDIJJQOUGC-CMDGGOBGSA-N |
| XLogP | 0.20 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|