C16H17N3O5 — CID 13060472
diethyl 2-[[(2-oxo-1H-quinazolin-4-yl)amino]methylidene]propanedioate (PubChem CID 13060472) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is diethyl 2-[[(2-oxo-1H-quinazolin-4-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2-oxo-1H-quinazolin-4-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 13060472 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | diethyl 2-[[(2-oxo-1H-quinazolin-4-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1nc(=O)[nH]c2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C16H17N3O5/c1-3-23-14(20)11(15(21)24-4-2)9-17-13-10-7-5-6-8-12(10)18-16(22)19-13/h5-9H,3-4H2,1-2H3,(H2,17,18,19,22) |
| InChIKey | RNRUHJMJFJKFIC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|