C20H24N4O6 — CID 10387190
diethyl 2-[[[(Z)-3-ethoxy-1-(1H-indazol-3-ylamino)-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate (PubChem CID 10387190) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is diethyl 2-[[[(Z)-3-ethoxy-1-(1H-indazol-3-ylamino)-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[(Z)-3-ethoxy-1-(1H-indazol-3-ylamino)-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 10387190 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | diethyl 2-[[[(Z)-3-ethoxy-1-(1H-indazol-3-ylamino)-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN/C(=C\Nc1n[nH]c2ccccc12)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H24N4O6/c1-4-28-18(25)14(19(26)29-5-2)11-21-16(20(27)30-6-3)12-22-17-13-9-7-8-10-15(13)23-24-17/h7-12,21H,4-6H2,1-3H3,(H2,22,23,24)/b16-12- |
| InChIKey | DDLFCTKHEUTLQJ-VBKFSLOCSA-N |
| XLogP | 1.98 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|