C18H22N4O8 — CID 15211360
diethyl 2-[[[(Z)-3-ethoxy-1-[(5-nitro-2-pyridinyl)amino]-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate (PubChem CID 15211360) has the molecular formula C18H22N4O8 and a molecular weight of 422.39 g/mol. Its IUPAC name is diethyl 2-[[[(Z)-3-ethoxy-1-[(5-nitro-2-pyridinyl)amino]-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[(Z)-3-ethoxy-1-[(5-nitro-2-pyridinyl)amino]-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 15211360 |
| Molecular Formula | C18H22N4O8 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | diethyl 2-[[[(Z)-3-ethoxy-1-[(5-nitro-2-pyridinyl)amino]-3-oxoprop-1-en-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN/C(=C\Nc1ccc([N+](=O)[O-])cn1)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H22N4O8/c1-4-28-16(23)13(17(24)29-5-2)10-19-14(18(25)30-6-3)11-21-15-8-7-12(9-20-15)22(26)27/h7-11,19H,4-6H2,1-3H3,(H,20,21)/b14-11- |
| InChIKey | UVXBMVCDPYKPEC-KAMYIIQDSA-N |
| XLogP | 1.41 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|