C14H20N4O4 — CID 134870282
diethyl 2-[[[5-(dimethylamino)pyrazin-2-yl]amino]methylidene]propanedioate (PubChem CID 134870282) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is diethyl 2-[[[5-(dimethylamino)pyrazin-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[5-(dimethylamino)pyrazin-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 134870282 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | diethyl 2-[[[5-(dimethylamino)pyrazin-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cnc(N(C)C)cn1)C(=O)OCC |
| InChI | InChI=1S/C14H20N4O4/c1-5-21-13(19)10(14(20)22-6-2)7-15-11-8-17-12(9-16-11)18(3)4/h7-9H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | IMDHGZCGGPQBPK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|