C13H12N4O2 — CID 122360524
ethyl (E)-2-cyano-3-(1H-indazol-3-ylamino)prop-2-enoate (PubChem CID 122360524) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(1H-indazol-3-ylamino)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(1H-indazol-3-ylamino)prop-2-enoate |
|---|---|
| PubChem CID | 122360524 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | ethyl (E)-2-cyano-3-(1H-indazol-3-ylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C13H12N4O2/c1-2-19-13(18)9(7-14)8-15-12-10-5-3-4-6-11(10)16-17-12/h3-6,8H,2H2,1H3,(H2,15,16,17)/b9-8+ |
| InChIKey | VRJCKTVRFLEWSL-CMDGGOBGSA-N |
| XLogP | 1.95 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|