C18H22N2O4 — CID 3954380
diethyl 2-[[(2,3-dimethyl-1H-indol-7-yl)amino]methylidene]propanedioate (PubChem CID 3954380) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is diethyl 2-[[(2,3-dimethyl-1H-indol-7-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2,3-dimethyl-1H-indol-7-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 3954380 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | diethyl 2-[[(2,3-dimethyl-1H-indol-7-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cccc2c(C)c(C)[nH]c12)C(=O)OCC |
| InChI | InChI=1S/C18H22N2O4/c1-5-23-17(21)14(18(22)24-6-2)10-19-15-9-7-8-13-11(3)12(4)20-16(13)15/h7-10,19-20H,5-6H2,1-4H3 |
| InChIKey | YXQWNEKBQOSSCG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|