C11H12N2O — CID 174861152
N-(2,3-dimethyl-1H-indol-7-yl)formamide (PubChem CID 174861152) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is N-(2,3-dimethyl-1H-indol-7-yl)formamide.
| Compound Name | N-(2,3-dimethyl-1H-indol-7-yl)formamide |
|---|---|
| PubChem CID | 174861152 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-(2,3-dimethyl-1H-indol-7-yl)formamide |
| SMILES | Cc1[nH]c2c(NC=O)cccc2c1C |
| InChI | InChI=1S/C11H12N2O/c1-7-8(2)13-11-9(7)4-3-5-10(11)12-6-14/h3-6,13H,1-2H3,(H,12,14) |
| InChIKey | IDDIDFARDDDSKV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|