C17H18N2O3S — CID 3456626
N-(2,3-dimethyl-1H-indol-7-yl)-4-methoxybenzenesulfonamide (PubChem CID 3456626) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(2,3-dimethyl-1H-indol-7-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(2,3-dimethyl-1H-indol-7-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3456626 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(2,3-dimethyl-1H-indol-7-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc3c(C)c(C)[nH]c23)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-11-12(2)18-17-15(11)5-4-6-16(17)19-23(20,21)14-9-7-13(22-3)8-10-14/h4-10,18-19H,1-3H3 |
| InChIKey | SYJJOYBZDOCMLT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|