C14H14FNO4S — CID 3576205
N-(2,3-dimethoxyphenyl)-4-fluorobenzenesulfonamide (PubChem CID 3576205) has the molecular formula C14H14FNO4S and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(2,3-dimethoxyphenyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3576205 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)-4-fluorobenzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C14H14FNO4S/c1-19-13-5-3-4-12(14(13)20-2)16-21(17,18)11-8-6-10(15)7-9-11/h3-9,16H,1-2H3 |
| InChIKey | BCONZLHMQKOUQY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |