About cesium;methylazanide;N-naphthalen-1-ylformamide
cesium;methylazanide;N-naphthalen-1-ylformamide (PubChem CID 145326564) has the molecular formula C12H13CsN2O
and a molecular weight of 334.15 g/mol. Its IUPAC name is cesium;methylazanide;N-naphthalen-1-ylformamide.
Molecular Properties
| Compound Name | cesium;methylazanide;N-naphthalen-1-ylformamide |
| PubChem CID | 145326564 |
| Molecular Formula | C12H13CsN2O |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | cesium;methylazanide;N-naphthalen-1-ylformamide |
| SMILES | C[NH-].O=CNc1cccc2ccccc12.[Cs+] |
| InChI | InChI=1S/C11H9NO.CH4N.Cs/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2;/h1-8H,(H,12,13);2H,1H3;/q;-1;+1 |
| InChIKey | OOFIVJGWULVYKJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cesium;methylazanide;N-naphthalen-1-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;methylazanide;N-naphthalen-1-ylformamide?
The IUPAC name of cesium;methylazanide;N-naphthalen-1-ylformamide (CID 145326564) is cesium;methylazanide;N-naphthalen-1-ylformamide.
What is the SMILES notation for cesium;methylazanide;N-naphthalen-1-ylformamide?
The canonical SMILES for cesium;methylazanide;N-naphthalen-1-ylformamide is C[NH-].O=CNc1cccc2ccccc12.[Cs+].
What is the InChIKey of cesium;methylazanide;N-naphthalen-1-ylformamide?
The InChIKey is OOFIVJGWULVYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.CH4N.Cs/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2;/h1-8H,(H,12,13);2H,1H3;/q;-1;+1.
What are the key properties of cesium;methylazanide;N-naphthalen-1-ylformamide?
cesium;methylazanide;N-naphthalen-1-ylformamide has a molecular weight of 334.15 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;methylazanide;N-naphthalen-1-ylformamide is sourced from PubChem (CID 145326564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).