About N-acridin-1-ylformamide
N-acridin-1-ylformamide (PubChem CID 174650417) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is N-acridin-1-ylformamide.
Molecular Properties
| Compound Name | N-acridin-1-ylformamide |
| PubChem CID | 174650417 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-acridin-1-ylformamide |
| SMILES | O=CNc1cccc2nc3ccccc3cc12 |
| InChI | InChI=1S/C14H10N2O/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14/h1-9H,(H,15,17) |
| InChIKey | ONNSQZKITZTOJR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-acridin-1-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acridin-1-ylformamide?
The IUPAC name of N-acridin-1-ylformamide (CID 174650417) is N-acridin-1-ylformamide.
What is the SMILES notation for N-acridin-1-ylformamide?
The canonical SMILES for N-acridin-1-ylformamide is O=CNc1cccc2nc3ccccc3cc12.
What is the InChIKey of N-acridin-1-ylformamide?
The InChIKey is ONNSQZKITZTOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14/h1-9H,(H,15,17).
What are the key properties of N-acridin-1-ylformamide?
N-acridin-1-ylformamide has a molecular weight of 222.25 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acridin-1-ylformamide is sourced from PubChem (CID 174650417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).