About acridine-1-sulfinic acid
acridine-1-sulfinic acid (PubChem CID 91240554) has the molecular formula C13H9NO2S
and a molecular weight of 243.29 g/mol. Its IUPAC name is acridine-1-sulfinic acid.
Molecular Properties
| Compound Name | acridine-1-sulfinic acid |
| PubChem CID | 91240554 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | acridine-1-sulfinic acid |
| SMILES | O=S(O)c1cccc2nc3ccccc3cc12 |
| InChI | InChI=1S/C13H9NO2S/c15-17(16)13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)14-12/h1-8H,(H,15,16) |
| InChIKey | IPOGTQIWBJQGJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze acridine-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine-1-sulfinic acid?
The IUPAC name of acridine-1-sulfinic acid (CID 91240554) is acridine-1-sulfinic acid.
What is the SMILES notation for acridine-1-sulfinic acid?
The canonical SMILES for acridine-1-sulfinic acid is O=S(O)c1cccc2nc3ccccc3cc12.
What is the InChIKey of acridine-1-sulfinic acid?
The InChIKey is IPOGTQIWBJQGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2S/c15-17(16)13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)14-12/h1-8H,(H,15,16).
What are the key properties of acridine-1-sulfinic acid?
acridine-1-sulfinic acid has a molecular weight of 243.29 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine-1-sulfinic acid is sourced from PubChem (CID 91240554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).