C20H22N4O6 — CID 5176579
ethyl N-[3-[(5-aminonaphthalen-1-yl)amino]-2-(ethoxycarbonylcarbamoyl)prop-2-enoyl]carbamate (PubChem CID 5176579) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is ethyl N-[3-[(5-aminonaphthalen-1-yl)amino]-2-(ethoxycarbonylcarbamoyl)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[3-[(5-aminonaphthalen-1-yl)amino]-2-(ethoxycarbonylcarbamoyl)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 5176579 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl N-[3-[(5-aminonaphthalen-1-yl)amino]-2-(ethoxycarbonylcarbamoyl)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(=CNc1cccc2c(N)cccc12)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C20H22N4O6/c1-3-29-19(27)23-17(25)14(18(26)24-20(28)30-4-2)11-22-16-10-6-7-12-13(16)8-5-9-15(12)21/h5-11,22H,3-4,21H2,1-2H3,(H,23,25,27)(H,24,26,28) |
| InChIKey | SNPIQKOYVWLDGU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|