C17H21N3O7 — CID 3493617
ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(2-methoxyanilino)prop-2-enoyl]carbamate (PubChem CID 3493617) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(2-methoxyanilino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(2-methoxyanilino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 3493617 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(2-methoxyanilino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(=CNc1ccccc1OC)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C17H21N3O7/c1-4-26-16(23)19-14(21)11(15(22)20-17(24)27-5-2)10-18-12-8-6-7-9-13(12)25-3/h6-10,18H,4-5H2,1-3H3,(H,19,21,23)(H,20,22,24) |
| InChIKey | RFNKBUMEGBPNFD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|