C23H23N3O6 — CID 45034303
ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(9H-fluoren-3-ylamino)prop-2-enoyl]carbamate (PubChem CID 45034303) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(9H-fluoren-3-ylamino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(9H-fluoren-3-ylamino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 45034303 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | ethyl N-[2-(ethoxycarbonylcarbamoyl)-3-(9H-fluoren-3-ylamino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(=CNc1ccc2c(c1)-c1ccccc1C2)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C23H23N3O6/c1-3-31-22(29)25-20(27)19(21(28)26-23(30)32-4-2)13-24-16-10-9-15-11-14-7-5-6-8-17(14)18(15)12-16/h5-10,12-13,24H,3-4,11H2,1-2H3,(H,25,27,29)(H,26,28,30) |
| InChIKey | RJLBLLOXFQOIIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|