About methanamine;N-(2-methoxyphenyl)formamide
methanamine;N-(2-methoxyphenyl)formamide (PubChem CID 143368119) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is methanamine;N-(2-methoxyphenyl)formamide.
Molecular Properties
| Compound Name | methanamine;N-(2-methoxyphenyl)formamide |
| PubChem CID | 143368119 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | methanamine;N-(2-methoxyphenyl)formamide |
| SMILES | CN.COc1ccccc1NC=O |
| InChI | InChI=1S/C8H9NO2.CH5N/c1-11-8-5-3-2-4-7(8)9-6-10;1-2/h2-6H,1H3,(H,9,10);2H2,1H3 |
| InChIKey | RWIXEDYNUJJGOC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanamine;N-(2-methoxyphenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;N-(2-methoxyphenyl)formamide?
The IUPAC name of methanamine;N-(2-methoxyphenyl)formamide (CID 143368119) is methanamine;N-(2-methoxyphenyl)formamide.
What is the SMILES notation for methanamine;N-(2-methoxyphenyl)formamide?
The canonical SMILES for methanamine;N-(2-methoxyphenyl)formamide is CN.COc1ccccc1NC=O.
What is the InChIKey of methanamine;N-(2-methoxyphenyl)formamide?
The InChIKey is RWIXEDYNUJJGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.CH5N/c1-11-8-5-3-2-4-7(8)9-6-10;1-2/h2-6H,1H3,(H,9,10);2H2,1H3.
What are the key properties of methanamine;N-(2-methoxyphenyl)formamide?
methanamine;N-(2-methoxyphenyl)formamide has a molecular weight of 182.22 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;N-(2-methoxyphenyl)formamide is sourced from PubChem (CID 143368119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).