C19H23N3O5 — CID 110178963
ethyl N-[3-(ethoxycarbonylamino)-4-(2-methoxyanilino)phenyl]carbamate (PubChem CID 110178963) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl N-[3-(ethoxycarbonylamino)-4-(2-methoxyanilino)phenyl]carbamate.
| Compound Name | ethyl N-[3-(ethoxycarbonylamino)-4-(2-methoxyanilino)phenyl]carbamate |
|---|---|
| PubChem CID | 110178963 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl N-[3-(ethoxycarbonylamino)-4-(2-methoxyanilino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccccc2OC)c(NC(=O)OCC)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-4-26-18(23)20-13-10-11-14(16(12-13)22-19(24)27-5-2)21-15-8-6-7-9-17(15)25-3/h6-12,21H,4-5H2,1-3H3,(H,20,23)(H,22,24) |
| InChIKey | HHCGSBYXKCRTGB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |