C15H18N2O7 — CID 12897325
ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]-4-methoxyanilino]-2-oxoacetate (PubChem CID 12897325) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]-4-methoxyanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]-4-methoxyanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 12897325 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]-4-methoxyanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc(OC)c(NC(=O)C(=O)OCC)c1 |
| InChI | InChI=1S/C15H18N2O7/c1-4-23-14(20)12(18)16-9-6-7-11(22-3)10(8-9)17-13(19)15(21)24-5-2/h6-8H,4-5H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | PGNXXYASNORBJH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|