C13H17NO5 — CID 115141832
ethyl 2-(2,5-dimethoxy-4-methylanilino)-2-oxoacetate (PubChem CID 115141832) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethoxy-4-methylanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(2,5-dimethoxy-4-methylanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 115141832 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-(2,5-dimethoxy-4-methylanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(OC)c(C)cc1OC |
| InChI | InChI=1S/C13H17NO5/c1-5-19-13(16)12(15)14-9-7-10(17-3)8(2)6-11(9)18-4/h6-7H,5H2,1-4H3,(H,14,15) |
| InChIKey | QFEPYSSWGMCGBR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|