C13H14N2O4S — CID 174606445
ethyl N-(4-aminonaphthalen-1-yl)sulfonylcarbamate (PubChem CID 174606445) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is ethyl N-(4-aminonaphthalen-1-yl)sulfonylcarbamate.
| Compound Name | ethyl N-(4-aminonaphthalen-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 174606445 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | ethyl N-(4-aminonaphthalen-1-yl)sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)c1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C13H14N2O4S/c1-2-19-13(16)15-20(17,18)12-8-7-11(14)9-5-3-4-6-10(9)12/h3-8H,2,14H2,1H3,(H,15,16) |
| InChIKey | RCPXQTAVUIEWAS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|