C14H15N3O5S — CID 67920315
2-[[2-[(4-aminonaphthalen-1-yl)sulfonylamino]acetyl]amino]acetic acid (PubChem CID 67920315) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-[[2-[(4-aminonaphthalen-1-yl)sulfonylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(4-aminonaphthalen-1-yl)sulfonylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 67920315 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[[2-[(4-aminonaphthalen-1-yl)sulfonylamino]acetyl]amino]acetic acid |
| SMILES | Nc1ccc(S(=O)(=O)NCC(=O)NCC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C14H15N3O5S/c15-11-5-6-12(10-4-2-1-3-9(10)11)23(21,22)17-7-13(18)16-8-14(19)20/h1-6,17H,7-8,15H2,(H,16,18)(H,19,20) |
| InChIKey | SMWIHUQCAXCCJL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|