C16H20N2O4S — CID 68798786
2-[(4-aminonaphthalen-1-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 68798786) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 68798786 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccc(N)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O4S/c1-10(2)9-14(16(19)20)18-23(21,22)15-8-7-13(17)11-5-3-4-6-12(11)15/h3-8,10,14,18H,9,17H2,1-2H3,(H,19,20) |
| InChIKey | GYFLIQAXGVVDKK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|