C27H33ClN4O4S — CID 69427822
2-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoic acid;1-chlorohexan-1-amine (PubChem CID 69427822) has the molecular formula C27H33ClN4O4S and a molecular weight of 545.11 g/mol. Its IUPAC name is 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoic acid;1-chlorohexan-1-amine.
| Compound Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoic acid;1-chlorohexan-1-amine |
|---|---|
| PubChem CID | 69427822 |
| Molecular Formula | C27H33ClN4O4S |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoic acid;1-chlorohexan-1-amine |
| SMILES | CCCCCC(N)Cl.Nc1ccc(S(=O)(=O)NC(Cc2c[nH]c3ccccc23)C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C21H19N3O4S.C6H14ClN/c22-17-9-10-20(16-7-2-1-6-15(16)17)29(27,28)24-19(21(25)26)11-13-12-23-18-8-4-3-5-14(13)18;1-2-3-4-5-6(7)8/h1-10,12,19,23-24H,11,22H2,(H,25,26);6H,2-5,8H2,1H3 |
| InChIKey | VHTJUQMUDSEDIM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|