C16H22N2O4S — CID 122069299
(2R)-2-[(1,2-dimethylindol-3-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 122069299) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is (2R)-2-[(1,2-dimethylindol-3-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(1,2-dimethylindol-3-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122069299 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2R)-2-[(1,2-dimethylindol-3-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | Cc1c(S(=O)(=O)N[C@H](CC(C)C)C(=O)O)c2ccccc2n1C |
| InChI | InChI=1S/C16H22N2O4S/c1-10(2)9-13(16(19)20)17-23(21,22)15-11(3)18(4)14-8-6-5-7-12(14)15/h5-8,10,13,17H,9H2,1-4H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | NPVUUKKYNGDFGF-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |