C10H10FNO2S — CID 82287934
1,2-dimethylindole-3-sulfonyl fluoride (PubChem CID 82287934) has the molecular formula C10H10FNO2S and a molecular weight of 227.26 g/mol. Its IUPAC name is 1,2-dimethylindole-3-sulfonyl fluoride.
| Compound Name | 1,2-dimethylindole-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 82287934 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 1,2-dimethylindole-3-sulfonyl fluoride |
| SMILES | Cc1c(S(=O)(=O)F)c2ccccc2n1C |
| InChI | InChI=1S/C10H10FNO2S/c1-7-10(15(11,13)14)8-5-3-4-6-9(8)12(7)2/h3-6H,1-2H3 |
| InChIKey | VTKZLOKCDJNIEH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |