C10H10IN — CID 19093282
3-iodo-1,2-dimethylindole (PubChem CID 19093282) has the molecular formula C10H10IN and a molecular weight of 271.10 g/mol. Its IUPAC name is 3-iodo-1,2-dimethylindole.
| Compound Name | 3-iodo-1,2-dimethylindole |
|---|---|
| PubChem CID | 19093282 |
| Molecular Formula | C10H10IN |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 3-iodo-1,2-dimethylindole |
| SMILES | Cc1c(I)c2ccccc2n1C |
| InChI | InChI=1S/C10H10IN/c1-7-10(11)8-5-3-4-6-9(8)12(7)2/h3-6H,1-2H3 |
| InChIKey | SSZIXUUGWDPQGJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|