C14H14INO — CID 102430889
1-(3-iodo-1-methylindol-2-yl)-2-methylbuta-2,3-dien-1-ol (PubChem CID 102430889) has the molecular formula C14H14INO and a molecular weight of 339.18 g/mol. Its IUPAC name is 1-(3-iodo-1-methylindol-2-yl)-2-methylbuta-2,3-dien-1-ol.
| Compound Name | 1-(3-iodo-1-methylindol-2-yl)-2-methylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 102430889 |
| Molecular Formula | C14H14INO |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-(3-iodo-1-methylindol-2-yl)-2-methylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(C)C(O)c1c(I)c2ccccc2n1C |
| InChI | InChI=1S/C14H14INO/c1-4-9(2)14(17)13-12(15)10-7-5-6-8-11(10)16(13)3/h5-8,14,17H,1H2,2-3H3 |
| InChIKey | YGNROLREVDGVTR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|