C14H15NO — CID 54756628
2-methyl-1-(1-methylindol-2-yl)buta-2,3-dien-1-ol (PubChem CID 54756628) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-methyl-1-(1-methylindol-2-yl)buta-2,3-dien-1-ol.
| Compound Name | 2-methyl-1-(1-methylindol-2-yl)buta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 54756628 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-methyl-1-(1-methylindol-2-yl)buta-2,3-dien-1-ol |
| SMILES | C=C=C(C)C(O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C14H15NO/c1-4-10(2)14(16)13-9-11-7-5-6-8-12(11)15(13)3/h5-9,14,16H,1H2,2-3H3 |
| InChIKey | ADKYIRQYYHAERT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |