About acetic acid;2-ethyl-1-methylindole
acetic acid;2-ethyl-1-methylindole (PubChem CID 70581856) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is acetic acid;2-ethyl-1-methylindole.
Molecular Properties
| Compound Name | acetic acid;2-ethyl-1-methylindole |
| PubChem CID | 70581856 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | acetic acid;2-ethyl-1-methylindole |
| SMILES | CC(=O)O.CCc1cc2ccccc2n1C |
| InChI | InChI=1S/C11H13N.C2H4O2/c1-3-10-8-9-6-4-5-7-11(9)12(10)2;1-2(3)4/h4-8H,3H2,1-2H3;1H3,(H,3,4) |
| InChIKey | SUXFQSUSJPTCSM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;2-ethyl-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-ethyl-1-methylindole?
The IUPAC name of acetic acid;2-ethyl-1-methylindole (CID 70581856) is acetic acid;2-ethyl-1-methylindole.
What is the SMILES notation for acetic acid;2-ethyl-1-methylindole?
The canonical SMILES for acetic acid;2-ethyl-1-methylindole is CC(=O)O.CCc1cc2ccccc2n1C.
What is the InChIKey of acetic acid;2-ethyl-1-methylindole?
The InChIKey is SUXFQSUSJPTCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.C2H4O2/c1-3-10-8-9-6-4-5-7-11(9)12(10)2;1-2(3)4/h4-8H,3H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-ethyl-1-methylindole?
acetic acid;2-ethyl-1-methylindole has a molecular weight of 219.28 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethyl-1-methylindole is sourced from PubChem (CID 70581856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).