About 1-methyl-2-propylindole
1-methyl-2-propylindole (PubChem CID 13170349) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-methyl-2-propylindole.
Molecular Properties
| Compound Name | 1-methyl-2-propylindole |
| PubChem CID | 13170349 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-methyl-2-propylindole |
| SMILES | CCCc1cc2ccccc2n1C |
| InChI | InChI=1S/C12H15N/c1-3-6-11-9-10-7-4-5-8-12(10)13(11)2/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | CYKBXXLTVVGRDK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2-propylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-propylindole?
The IUPAC name of 1-methyl-2-propylindole (CID 13170349) is 1-methyl-2-propylindole.
What is the SMILES notation for 1-methyl-2-propylindole?
The canonical SMILES for 1-methyl-2-propylindole is CCCc1cc2ccccc2n1C.
What is the InChIKey of 1-methyl-2-propylindole?
The InChIKey is CYKBXXLTVVGRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-3-6-11-9-10-7-4-5-8-12(10)13(11)2/h4-5,7-9H,3,6H2,1-2H3.
What are the key properties of 1-methyl-2-propylindole?
1-methyl-2-propylindole has a molecular weight of 173.26 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-propylindole is sourced from PubChem (CID 13170349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).