About ethane;1,2,3-trimethylindole
ethane;1,2,3-trimethylindole (PubChem CID 91590745) has the molecular formula C19H37N
and a molecular weight of 279.51 g/mol. Its IUPAC name is ethane;1,2,3-trimethylindole.
Molecular Properties
| Compound Name | ethane;1,2,3-trimethylindole |
| PubChem CID | 91590745 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | ethane;1,2,3-trimethylindole |
| SMILES | CC.CC.CC.CC.Cc1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C11H13N.4C2H6/c1-8-9(2)12(3)11-7-5-4-6-10(8)11;4*1-2/h4-7H,1-3H3;4*1-2H3 |
| InChIKey | IIGSHUXILMORKA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze ethane;1,2,3-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,2,3-trimethylindole?
The IUPAC name of ethane;1,2,3-trimethylindole (CID 91590745) is ethane;1,2,3-trimethylindole.
What is the SMILES notation for ethane;1,2,3-trimethylindole?
The canonical SMILES for ethane;1,2,3-trimethylindole is CC.CC.CC.CC.Cc1c(C)n(C)c2ccccc12.
What is the InChIKey of ethane;1,2,3-trimethylindole?
The InChIKey is IIGSHUXILMORKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.4C2H6/c1-8-9(2)12(3)11-7-5-4-6-10(8)11;4*1-2/h4-7H,1-3H3;4*1-2H3.
What are the key properties of ethane;1,2,3-trimethylindole?
ethane;1,2,3-trimethylindole has a molecular weight of 279.51 g/mol, XLogP of 6.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,2,3-trimethylindole is sourced from PubChem (CID 91590745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).