C17H27N — CID 144783393
1,3-dimethyl-2-[(Z)-prop-1-enyl]indole;ethane (PubChem CID 144783393) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(Z)-prop-1-enyl]indole;ethane.
| Compound Name | 1,3-dimethyl-2-[(Z)-prop-1-enyl]indole;ethane |
|---|---|
| PubChem CID | 144783393 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1,3-dimethyl-2-[(Z)-prop-1-enyl]indole;ethane |
| SMILES | C/C=C\c1c(C)c2ccccc2n1C.CC.CC |
| InChI | InChI=1S/C13H15N.2C2H6/c1-4-7-12-10(2)11-8-5-6-9-13(11)14(12)3;2*1-2/h4-9H,1-3H3;2*1-2H3/b7-4-;; |
| InChIKey | JGCMWZIWDHGXTG-XIFWRFGDSA-N |
| XLogP | 5.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |