C16H22N2 — CID 145463492
1-(1,3-dimethylindol-2-yl)-N-prop-1-en-2-ylmethanimine;ethane (PubChem CID 145463492) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-(1,3-dimethylindol-2-yl)-N-prop-1-en-2-ylmethanimine;ethane.
| Compound Name | 1-(1,3-dimethylindol-2-yl)-N-prop-1-en-2-ylmethanimine;ethane |
|---|---|
| PubChem CID | 145463492 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(1,3-dimethylindol-2-yl)-N-prop-1-en-2-ylmethanimine;ethane |
| SMILES | C=C(C)/N=C/c1c(C)c2ccccc2n1C.CC |
| InChI | InChI=1S/C14H16N2.C2H6/c1-10(2)15-9-14-11(3)12-7-5-6-8-13(12)16(14)4;1-2/h5-9H,1H2,2-4H3;1-2H3/b15-9+; |
| InChIKey | HGKAHIOXDXRGMV-NSPIFIKESA-N |
| XLogP | 4.47 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|